C30H23BrN2O4 — CID 94479075
[2-methoxy-4-[(8S)-9-oxo-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-8-yl]phenyl] 4-bromobenzoate (PubChem CID 94479075) has the molecular formula C30H23BrN2O4 and a molecular weight of 555.43 g/mol. Its IUPAC name is [2-methoxy-4-[(8S)-9-oxo-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-8-yl]phenyl] 4-bromobenzoate.
| Compound Name | [2-methoxy-4-[(8S)-9-oxo-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-8-yl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 94479075 |
| Molecular Formula | C30H23BrN2O4 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | [2-methoxy-4-[(8S)-9-oxo-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-8-yl]phenyl] 4-bromobenzoate |
| SMILES | COc1cc([C@@H]2Nc3ccc4ncccc4c3C3=C2C(=O)CCC3)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H23BrN2O4/c1-36-26-16-18(9-14-25(26)37-30(35)17-7-10-19(31)11-8-17)29-28-21(4-2-6-24(28)34)27-20-5-3-15-32-22(20)12-13-23(27)33-29/h3,5,7-16,29,33H,2,4,6H2,1H3/t29-/m0/s1 |
| InChIKey | KMTDCBMCAVUUBU-LJAQVGFWSA-N |
| XLogP | 6.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|