C26H23NO4 — CID 3580186
[2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] acetate (PubChem CID 3580186) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] acetate |
|---|---|
| PubChem CID | 3580186 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [2-methoxy-4-(4-oxo-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-5-yl)phenyl] acetate |
| SMILES | COc1cc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CCC3)ccc1OC(C)=O |
| InChI | InChI=1S/C26H23NO4/c1-15(28)31-22-13-11-17(14-23(22)30-2)26-25-19(8-5-9-21(25)29)24-18-7-4-3-6-16(18)10-12-20(24)27-26/h3-4,6-7,10-14,26-27H,5,8-9H2,1-2H3 |
| InChIKey | UFHCKHSFVRJUEO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|