C28H27NO4 — CID 1079452
[5-[(5R)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-methoxyphenyl] acetate (PubChem CID 1079452) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is [5-[(5R)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[(5R)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1079452 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [5-[(5R)-2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc([C@H]2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)cc1OC(C)=O |
| InChI | InChI=1S/C28H27NO4/c1-16(30)33-24-13-18(10-12-23(24)32-4)27-26-20(14-28(2,3)15-22(26)31)25-19-8-6-5-7-17(19)9-11-21(25)29-27/h5-13,27,29H,14-15H2,1-4H3/t27-/m1/s1 |
| InChIKey | MKWYUHYBWXUTCR-HHHXNRCGSA-N |
| XLogP | 6.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|