C30H31NO5 — CID 2893237
2-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)-2-methoxyphenoxy]ethyl acetate (PubChem CID 2893237) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)-2-methoxyphenoxy]ethyl acetate.
| Compound Name | 2-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)-2-methoxyphenoxy]ethyl acetate |
|---|---|
| PubChem CID | 2893237 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[4-(2,2-dimethyl-4-oxo-1,3,5,6-tetrahydrobenzo[a]phenanthridin-5-yl)-2-methoxyphenoxy]ethyl acetate |
| SMILES | COc1cc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)ccc1OCCOC(C)=O |
| InChI | InChI=1S/C30H31NO5/c1-18(32)35-13-14-36-25-12-10-20(15-26(25)34-4)29-28-22(16-30(2,3)17-24(28)33)27-21-8-6-5-7-19(21)9-11-23(27)31-29/h5-12,15,29,31H,13-14,16-17H2,1-4H3 |
| InChIKey | BCBAPHBTROTDSW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|