C23H21NO4 — CID 1261142
[2-methoxy-4-[(3R)-1-oxo-3,4-dihydro-2H-benzo[f]quinolin-3-yl]phenyl] propanoate (PubChem CID 1261142) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [2-methoxy-4-[(3R)-1-oxo-3,4-dihydro-2H-benzo[f]quinolin-3-yl]phenyl] propanoate.
| Compound Name | [2-methoxy-4-[(3R)-1-oxo-3,4-dihydro-2H-benzo[f]quinolin-3-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 1261142 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-methoxy-4-[(3R)-1-oxo-3,4-dihydro-2H-benzo[f]quinolin-3-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc([C@H]2CC(=O)c3c(ccc4ccccc34)N2)cc1OC |
| InChI | InChI=1S/C23H21NO4/c1-3-22(26)28-20-11-9-15(12-21(20)27-2)18-13-19(25)23-16-7-5-4-6-14(16)8-10-17(23)24-18/h4-12,18,24H,3,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | AGYKHIAIMCVHHP-GOSISDBHSA-N |
| XLogP | 4.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|