C23H23NO3S — CID 26319479
[(3R)-1-[5-(methoxymethyl)thiophene-2-carbonyl]piperidin-3-yl]-naphthalen-2-ylmethanone (PubChem CID 26319479) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [(3R)-1-[5-(methoxymethyl)thiophene-2-carbonyl]piperidin-3-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(3R)-1-[5-(methoxymethyl)thiophene-2-carbonyl]piperidin-3-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 26319479 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3R)-1-[5-(methoxymethyl)thiophene-2-carbonyl]piperidin-3-yl]-naphthalen-2-ylmethanone |
| SMILES | COCc1ccc(C(=O)N2CCC[C@@H](C(=O)c3ccc4ccccc4c3)C2)s1 |
| InChI | InChI=1S/C23H23NO3S/c1-27-15-20-10-11-21(28-20)23(26)24-12-4-7-19(14-24)22(25)18-9-8-16-5-2-3-6-17(16)13-18/h2-3,5-6,8-11,13,19H,4,7,12,14-15H2,1H3/t19-/m1/s1 |
| InChIKey | PYQSIVFRZAZMRX-LJQANCHMSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |