C22H27N5O2 — CID 26320525
N-[(4R)-1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)propanamide (PubChem CID 26320525) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(4R)-1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)propanamide.
| Compound Name | N-[(4R)-1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)propanamide |
|---|---|
| PubChem CID | 26320525 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[(4R)-1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)propanamide |
| SMILES | Cc1ccc(-n2ncc3c2CCC[C@H]3NC(=O)CCC2=NNC(=O)CC2)cc1C |
| InChI | InChI=1S/C22H27N5O2/c1-14-6-9-17(12-15(14)2)27-20-5-3-4-19(18(20)13-23-27)24-21(28)10-7-16-8-11-22(29)26-25-16/h6,9,12-13,19H,3-5,7-8,10-11H2,1-2H3,(H,24,28)(H,26,29)/t19-/m1/s1 |
| InChIKey | XCTGAFDBEXOFFL-LJQANCHMSA-N |
| XLogP | 3.03 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |