C19H22F3N3O — CID 45211075
N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-4,4,4-trifluorobutanamide (PubChem CID 45211075) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 45211075 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-4,4,4-trifluorobutanamide |
| SMILES | Cc1ccc(-n2ncc3c2CCCC3NC(=O)CCC(F)(F)F)cc1C |
| InChI | InChI=1S/C19H22F3N3O/c1-12-6-7-14(10-13(12)2)25-17-5-3-4-16(15(17)11-23-25)24-18(26)8-9-19(20,21)22/h6-7,10-11,16H,3-5,8-9H2,1-2H3,(H,24,26) |
| InChIKey | HACVFGVJAGSJML-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |