C18H23N5O2 — CID 26325576
1-[2-(cyclobutanecarbonylamino)ethyl]-N-[(4-methylphenyl)methyl]triazole-4-carboxamide (PubChem CID 26325576) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[2-(cyclobutanecarbonylamino)ethyl]-N-[(4-methylphenyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[2-(cyclobutanecarbonylamino)ethyl]-N-[(4-methylphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 26325576 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[2-(cyclobutanecarbonylamino)ethyl]-N-[(4-methylphenyl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cn(CCNC(=O)C3CCC3)nn2)cc1 |
| InChI | InChI=1S/C18H23N5O2/c1-13-5-7-14(8-6-13)11-20-18(25)16-12-23(22-21-16)10-9-19-17(24)15-3-2-4-15/h5-8,12,15H,2-4,9-11H2,1H3,(H,19,24)(H,20,25) |
| InChIKey | DXEOGJWDHQVVKS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |