C17H19FN2OS — CID 26326661
(4S)-1-[(4-fluorophenyl)methyl]-4-[(5-methylthiophen-2-yl)methylamino]pyrrolidin-2-one (PubChem CID 26326661) has the molecular formula C17H19FN2OS and a molecular weight of 318.42 g/mol. Its IUPAC name is (4S)-1-[(4-fluorophenyl)methyl]-4-[(5-methylthiophen-2-yl)methylamino]pyrrolidin-2-one.
| Compound Name | (4S)-1-[(4-fluorophenyl)methyl]-4-[(5-methylthiophen-2-yl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26326661 |
| Molecular Formula | C17H19FN2OS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (4S)-1-[(4-fluorophenyl)methyl]-4-[(5-methylthiophen-2-yl)methylamino]pyrrolidin-2-one |
| SMILES | Cc1ccc(CN[C@H]2CC(=O)N(Cc3ccc(F)cc3)C2)s1 |
| InChI | InChI=1S/C17H19FN2OS/c1-12-2-7-16(22-12)9-19-15-8-17(21)20(11-15)10-13-3-5-14(18)6-4-13/h2-7,15,19H,8-11H2,1H3/t15-/m0/s1 |
| InChIKey | LOLUABDMGNQODU-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |