C26H25ClN2O4 — CID 26331398
methyl (2S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[(2-phenylbenzoyl)amino]pyrrolidine-2-carboxylate (PubChem CID 26331398) has the molecular formula C26H25ClN2O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is methyl (2S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[(2-phenylbenzoyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[(2-phenylbenzoyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 26331398 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl (2S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[(2-phenylbenzoyl)amino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](NC(=O)c2ccccc2-c2ccccc2)CN1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C26H25ClN2O4/c1-33-26(32)23-14-20(16-29(23)15-18-13-19(27)11-12-24(18)30)28-25(31)22-10-6-5-9-21(22)17-7-3-2-4-8-17/h2-13,20,23,30H,14-16H2,1H3,(H,28,31)/t20-,23+/m1/s1 |
| InChIKey | DTTPFDKXQNJNBF-OFNKIYASSA-N |
| XLogP | 4.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|