C23H27N3O2 — CID 72890005
(2S,4S)-N-ethyl-4-[(2-phenylbenzoyl)amino]-1-prop-2-enylpyrrolidine-2-carboxamide (PubChem CID 72890005) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is (2S,4S)-N-ethyl-4-[(2-phenylbenzoyl)amino]-1-prop-2-enylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-ethyl-4-[(2-phenylbenzoyl)amino]-1-prop-2-enylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72890005 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (2S,4S)-N-ethyl-4-[(2-phenylbenzoyl)amino]-1-prop-2-enylpyrrolidine-2-carboxamide |
| SMILES | C=CCN1C[C@@H](NC(=O)c2ccccc2-c2ccccc2)C[C@H]1C(=O)NCC |
| InChI | InChI=1S/C23H27N3O2/c1-3-14-26-16-18(15-21(26)23(28)24-4-2)25-22(27)20-13-9-8-12-19(20)17-10-6-5-7-11-17/h3,5-13,18,21H,1,4,14-16H2,2H3,(H,24,28)(H,25,27)/t18-,21-/m0/s1 |
| InChIKey | JIZATTHTGVMIFV-RXVVDRJESA-N |
| XLogP | 2.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|