C18H27N5O4 — CID 72883115
N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylbut-2-enyl)pyrrolidin-3-yl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 72883115) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylbut-2-enyl)pyrrolidin-3-yl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylbut-2-enyl)pyrrolidin-3-yl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72883115 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylbut-2-enyl)pyrrolidin-3-yl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@H](NC(=O)c2cn(C)c(=O)[nH]c2=O)CN1CC=C(C)C |
| InChI | InChI=1S/C18H27N5O4/c1-5-19-17(26)14-8-12(9-23(14)7-6-11(2)3)20-15(24)13-10-22(4)18(27)21-16(13)25/h6,10,12,14H,5,7-9H2,1-4H3,(H,19,26)(H,20,24)(H,21,25,27)/t12-,14-/m0/s1 |
| InChIKey | HEMJNAYPKLPFAE-JSGCOSHPSA-N |
| XLogP | -0.65 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|