C17H27N5O2S — CID 72862078
N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-4-methylpyrimidine-5-carboxamide (PubChem CID 72862078) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72862078 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(3-methylsulfanylpropyl)pyrrolidin-3-yl]-4-methylpyrimidine-5-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@H](NC(=O)c2cncnc2C)CN1CCCSC |
| InChI | InChI=1S/C17H27N5O2S/c1-4-19-17(24)15-8-13(10-22(15)6-5-7-25-3)21-16(23)14-9-18-11-20-12(14)2/h9,11,13,15H,4-8,10H2,1-3H3,(H,19,24)(H,21,23)/t13-,15-/m0/s1 |
| InChIKey | SQZHUWJZPOZPNM-ZFWWWQNUSA-N |
| XLogP | 0.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|