C9H11N3O — CID 110848001
N-cyclopropyl-4-methylpyrimidine-5-carboxamide (PubChem CID 110848001) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is N-cyclopropyl-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-cyclopropyl-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110848001 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-cyclopropyl-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncncc1C(=O)NC1CC1 |
| InChI | InChI=1S/C9H11N3O/c1-6-8(4-10-5-11-6)9(13)12-7-2-3-7/h4-5,7H,2-3H2,1H3,(H,12,13) |
| InChIKey | IGBKWYYWZHUUHL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |