C8H8N4O — CID 130662590
N-(cyanomethyl)-4-methylpyrimidine-5-carboxamide (PubChem CID 130662590) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-(cyanomethyl)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130662590 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-(cyanomethyl)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncncc1C(=O)NCC#N |
| InChI | InChI=1S/C8H8N4O/c1-6-7(4-10-5-12-6)8(13)11-3-2-9/h4-5H,3H2,1H3,(H,11,13) |
| InChIKey | LXCVYMAVIYEFQX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|