C10H17ClN4O — CID 119507049
N-[2-(ethylamino)ethyl]-4-methylpyrimidine-5-carboxamide;hydrochloride (PubChem CID 119507049) has the molecular formula C10H17ClN4O and a molecular weight of 244.73 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-methylpyrimidine-5-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-4-methylpyrimidine-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119507049 |
| Molecular Formula | C10H17ClN4O |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-methylpyrimidine-5-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cncnc1C.Cl |
| InChI | InChI=1S/C10H16N4O.ClH/c1-3-11-4-5-13-10(15)9-6-12-7-14-8(9)2;/h6-7,11H,3-5H2,1-2H3,(H,13,15);1H |
| InChIKey | TTWONKALTINOJF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|