C9H15N3O2 — CID 62657278
N-[2-(ethylamino)ethyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 62657278) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-(ethylamino)ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 62657278 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCNCCNC(=O)c1cnoc1C |
| InChI | InChI=1S/C9H15N3O2/c1-3-10-4-5-11-9(13)8-6-12-14-7(8)2/h6,10H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | YCEUGJAAOJATKM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|