C9H13ClN2O3 — CID 114297508
N-[2-(2-chloroethoxy)ethyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 114297508) has the molecular formula C9H13ClN2O3 and a molecular weight of 232.67 g/mol. Its IUPAC name is N-[2-(2-chloroethoxy)ethyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-(2-chloroethoxy)ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 114297508 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | N-[2-(2-chloroethoxy)ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)NCCOCCCl |
| InChI | InChI=1S/C9H13ClN2O3/c1-7-8(6-12-15-7)9(13)11-3-5-14-4-2-10/h6H,2-5H2,1H3,(H,11,13) |
| InChIKey | IZMLQFNDGRXJQJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|