C22H33N3O2 — CID 72865853
(2S,4R)-N-ethyl-1-(3-methylbut-2-enyl)-4-[(4-propylbenzoyl)amino]pyrrolidine-2-carboxamide (PubChem CID 72865853) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is (2S,4R)-N-ethyl-1-(3-methylbut-2-enyl)-4-[(4-propylbenzoyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-ethyl-1-(3-methylbut-2-enyl)-4-[(4-propylbenzoyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72865853 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (2S,4R)-N-ethyl-1-(3-methylbut-2-enyl)-4-[(4-propylbenzoyl)amino]pyrrolidine-2-carboxamide |
| SMILES | CCCc1ccc(C(=O)N[C@@H]2C[C@@H](C(=O)NCC)N(CC=C(C)C)C2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c1-5-7-17-8-10-18(11-9-17)21(26)24-19-14-20(22(27)23-6-2)25(15-19)13-12-16(3)4/h8-12,19-20H,5-7,13-15H2,1-4H3,(H,23,27)(H,24,26)/t19-,20+/m1/s1 |
| InChIKey | LOQLWTYWYUBKSO-UXHICEINSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|