C21H28N4O2 — CID 72857859
N-[(3R,5S)-5-(ethylcarbamoyl)-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-1H-indole-6-carboxamide (PubChem CID 72857859) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(3R,5S)-5-(ethylcarbamoyl)-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-1H-indole-6-carboxamide.
| Compound Name | N-[(3R,5S)-5-(ethylcarbamoyl)-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 72857859 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[(3R,5S)-5-(ethylcarbamoyl)-1-[(E)-2-methylbut-2-enyl]pyrrolidin-3-yl]-1H-indole-6-carboxamide |
| SMILES | C/C=C(\C)CN1C[C@H](NC(=O)c2ccc3cc[nH]c3c2)C[C@H]1C(=O)NCC |
| InChI | InChI=1S/C21H28N4O2/c1-4-14(3)12-25-13-17(11-19(25)21(27)22-5-2)24-20(26)16-7-6-15-8-9-23-18(15)10-16/h4,6-10,17,19,23H,5,11-13H2,1-3H3,(H,22,27)(H,24,26)/b14-4+/t17-,19+/m1/s1 |
| InChIKey | FIKXBTXZUGHNQW-AHCNFZPHSA-N |
| XLogP | 2.44 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|