C20H29N3O3 — CID 72907895
(2S,4R)-N-ethyl-4-[(3-hydroxy-4-methylbenzoyl)amino]-1-(3-methylbut-2-enyl)pyrrolidine-2-carboxamide (PubChem CID 72907895) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S,4R)-N-ethyl-4-[(3-hydroxy-4-methylbenzoyl)amino]-1-(3-methylbut-2-enyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-ethyl-4-[(3-hydroxy-4-methylbenzoyl)amino]-1-(3-methylbut-2-enyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72907895 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2S,4R)-N-ethyl-4-[(3-hydroxy-4-methylbenzoyl)amino]-1-(3-methylbut-2-enyl)pyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@@H](NC(=O)c2ccc(C)c(O)c2)CN1CC=C(C)C |
| InChI | InChI=1S/C20H29N3O3/c1-5-21-20(26)17-11-16(12-23(17)9-8-13(2)3)22-19(25)15-7-6-14(4)18(24)10-15/h6-8,10,16-17,24H,5,9,11-12H2,1-4H3,(H,21,26)(H,22,25)/t16-,17+/m1/s1 |
| InChIKey | CUQHZNHDMBKPOH-SJORKVTESA-N |
| XLogP | 1.98 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|