C20H28FN3O3 — CID 91940656
(2S,4S)-N-ethyl-4-[(4-fluoro-3-methoxybenzoyl)amino]-1-(2-methylbut-2-enyl)pyrrolidine-2-carboxamide (PubChem CID 91940656) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is (2S,4S)-N-ethyl-4-[(4-fluoro-3-methoxybenzoyl)amino]-1-(2-methylbut-2-enyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-ethyl-4-[(4-fluoro-3-methoxybenzoyl)amino]-1-(2-methylbut-2-enyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91940656 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (2S,4S)-N-ethyl-4-[(4-fluoro-3-methoxybenzoyl)amino]-1-(2-methylbut-2-enyl)pyrrolidine-2-carboxamide |
| SMILES | CC=C(C)CN1C[C@@H](NC(=O)c2ccc(F)c(OC)c2)C[C@H]1C(=O)NCC |
| InChI | InChI=1S/C20H28FN3O3/c1-5-13(3)11-24-12-15(10-17(24)20(26)22-6-2)23-19(25)14-7-8-16(21)18(9-14)27-4/h5,7-9,15,17H,6,10-12H2,1-4H3,(H,22,26)(H,23,25)/t15-,17-/m0/s1 |
| InChIKey | PMIOUIAAMWPURF-RDJZCZTQSA-N |
| XLogP | 2.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|