C14H17ClFNO2 — CID 113271600
N-(4-chlorocyclohexyl)-4-fluoro-3-methoxybenzamide (PubChem CID 113271600) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is N-(4-chlorocyclohexyl)-4-fluoro-3-methoxybenzamide.
| Compound Name | N-(4-chlorocyclohexyl)-4-fluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 113271600 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(4-chlorocyclohexyl)-4-fluoro-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCC(Cl)CC2)ccc1F |
| InChI | InChI=1S/C14H17ClFNO2/c1-19-13-8-9(2-7-12(13)16)14(18)17-11-5-3-10(15)4-6-11/h2,7-8,10-11H,3-6H2,1H3,(H,17,18) |
| InChIKey | XNZJOKCEPUSDHU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|