C16H22FNO3 — CID 99776479
4-fluoro-N-[(1R,2R)-2-(hydroxymethyl)cycloheptyl]-3-methoxybenzamide (PubChem CID 99776479) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,2R)-2-(hydroxymethyl)cycloheptyl]-3-methoxybenzamide.
| Compound Name | 4-fluoro-N-[(1R,2R)-2-(hydroxymethyl)cycloheptyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 99776479 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-fluoro-N-[(1R,2R)-2-(hydroxymethyl)cycloheptyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCCCC[C@H]2CO)ccc1F |
| InChI | InChI=1S/C16H22FNO3/c1-21-15-9-11(7-8-13(15)17)16(20)18-14-6-4-2-3-5-12(14)10-19/h7-9,12,14,19H,2-6,10H2,1H3,(H,18,20)/t12-,14+/m0/s1 |
| InChIKey | CDNKTKCEZWAICC-GXTWGEPZSA-N |
| XLogP | 2.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |