C20H31N3O2S — CID 156606803
N,N-diethyl-1-(3-methylbut-2-enyl)-4-[(5-methylthiophene-2-carbonyl)amino]pyrrolidine-2-carboxamide (PubChem CID 156606803) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is N,N-diethyl-1-(3-methylbut-2-enyl)-4-[(5-methylthiophene-2-carbonyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | N,N-diethyl-1-(3-methylbut-2-enyl)-4-[(5-methylthiophene-2-carbonyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156606803 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N,N-diethyl-1-(3-methylbut-2-enyl)-4-[(5-methylthiophene-2-carbonyl)amino]pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)C1CC(NC(=O)c2ccc(C)s2)CN1CC=C(C)C |
| InChI | InChI=1S/C20H31N3O2S/c1-6-22(7-2)20(25)17-12-16(13-23(17)11-10-14(3)4)21-19(24)18-9-8-15(5)26-18/h8-10,16-17H,6-7,11-13H2,1-5H3,(H,21,24) |
| InChIKey | WWELNCGWKLMARP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|