C25H28N2O3 — CID 26334422
ethyl (3S)-1-(1H-indole-5-carbonyl)-3-(2-phenylethyl)piperidine-3-carboxylate (PubChem CID 26334422) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is ethyl (3S)-1-(1H-indole-5-carbonyl)-3-(2-phenylethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(1H-indole-5-carbonyl)-3-(2-phenylethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26334422 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethyl (3S)-1-(1H-indole-5-carbonyl)-3-(2-phenylethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCc2ccccc2)CCCN(C(=O)c2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C25H28N2O3/c1-2-30-24(29)25(14-11-19-7-4-3-5-8-19)13-6-16-27(18-25)23(28)21-9-10-22-20(17-21)12-15-26-22/h3-5,7-10,12,15,17,26H,2,6,11,13-14,16,18H2,1H3/t25-/m1/s1 |
| InChIKey | OJNSPQWHAHVJGG-RUZDIDTESA-N |
| XLogP | 4.59 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |