C18H21N5O2S2 — CID 26334572
N-(2-acetamidoethyl)-5-methyl-4-[[(1R)-1-thiophen-2-ylethyl]amino]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 26334572) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-5-methyl-4-[[(1R)-1-thiophen-2-ylethyl]amino]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-5-methyl-4-[[(1R)-1-thiophen-2-ylethyl]amino]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 26334572 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-(2-acetamidoethyl)-5-methyl-4-[[(1R)-1-thiophen-2-ylethyl]amino]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1sc2ncnc(N[C@H](C)c3cccs3)c2c1C |
| InChI | InChI=1S/C18H21N5O2S2/c1-10-14-16(23-11(2)13-5-4-8-26-13)21-9-22-18(14)27-15(10)17(25)20-7-6-19-12(3)24/h4-5,8-9,11H,6-7H2,1-3H3,(H,19,24)(H,20,25)(H,21,22,23)/t11-/m1/s1 |
| InChIKey | CDXZKRMSARGAEV-LLVKDONJSA-N |
| XLogP | 3.10 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|