C22H23N5OS2 — CID 45198809
5-methyl-N-(3-pyridin-4-ylpropyl)-4-(1-thiophen-2-ylethylamino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 45198809) has the molecular formula C22H23N5OS2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 5-methyl-N-(3-pyridin-4-ylpropyl)-4-(1-thiophen-2-ylethylamino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-N-(3-pyridin-4-ylpropyl)-4-(1-thiophen-2-ylethylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 45198809 |
| Molecular Formula | C22H23N5OS2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 5-methyl-N-(3-pyridin-4-ylpropyl)-4-(1-thiophen-2-ylethylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCc2ccncc2)sc2ncnc(NC(C)c3cccs3)c12 |
| InChI | InChI=1S/C22H23N5OS2/c1-14-18-20(27-15(2)17-6-4-12-29-17)25-13-26-22(18)30-19(14)21(28)24-9-3-5-16-7-10-23-11-8-16/h4,6-8,10-13,15H,3,5,9H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | OLFCUFCHEVLCER-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|