C19H23N5O2S — CID 26276087
4-(2-methoxyethylamino)-5-methyl-N-(3-pyridin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 26276087) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-5-methyl-N-(3-pyridin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(2-methoxyethylamino)-5-methyl-N-(3-pyridin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 26276087 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-(2-methoxyethylamino)-5-methyl-N-(3-pyridin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCNc1ncnc2sc(C(=O)NCCCc3ccncc3)c(C)c12 |
| InChI | InChI=1S/C19H23N5O2S/c1-13-15-17(21-10-11-26-2)23-12-24-19(15)27-16(13)18(25)22-7-3-4-14-5-8-20-9-6-14/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,22,25)(H,21,23,24) |
| InChIKey | YNYQMYNZPLGSIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|