C23H25N5O2S2 — CID 26352818
N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 26352818) has the molecular formula C23H25N5O2S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 26352818 |
| Molecular Formula | C23H25N5O2S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCCNc1ncnc2sc(C(=O)NCc3csc(Cc4ccccc4)n3)c(C)c12 |
| InChI | InChI=1S/C23H25N5O2S2/c1-15-19-21(24-9-6-10-30-2)26-14-27-23(19)32-20(15)22(29)25-12-17-13-31-18(28-17)11-16-7-4-3-5-8-16/h3-5,7-8,13-14H,6,9-12H2,1-2H3,(H,25,29)(H,24,26,27) |
| InChIKey | OPNIBBQZGMOBMG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|