C15H22N4O2S2 — CID 42449732
4-(3-methoxypropylamino)-5-methyl-N-(2-methylsulfanylethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 42449732) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(3-methoxypropylamino)-5-methyl-N-(2-methylsulfanylethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(3-methoxypropylamino)-5-methyl-N-(2-methylsulfanylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 42449732 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-(3-methoxypropylamino)-5-methyl-N-(2-methylsulfanylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCCNc1ncnc2sc(C(=O)NCCSC)c(C)c12 |
| InChI | InChI=1S/C15H22N4O2S2/c1-10-11-13(16-5-4-7-21-2)18-9-19-15(11)23-12(10)14(20)17-6-8-22-3/h9H,4-8H2,1-3H3,(H,17,20)(H,16,18,19) |
| InChIKey | GTSDHTVVKQJBSX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|