C25H32N2O4 — CID 26334650
[7-[(S)-cyclohexyl(methoxy)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone (PubChem CID 26334650) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [7-[(S)-cyclohexyl(methoxy)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone.
| Compound Name | [7-[(S)-cyclohexyl(methoxy)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone |
|---|---|
| PubChem CID | 26334650 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [7-[(S)-cyclohexyl(methoxy)methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone |
| SMILES | CO[C@H](c1ccc2c(c1)CN(C(=O)c1noc3c1CCCC3)CCO2)C1CCCCC1 |
| InChI | InChI=1S/C25H32N2O4/c1-29-24(17-7-3-2-4-8-17)18-11-12-21-19(15-18)16-27(13-14-30-21)25(28)23-20-9-5-6-10-22(20)31-26-23/h11-12,15,17,24H,2-10,13-14,16H2,1H3/t24-/m0/s1 |
| InChIKey | BEUCUDJZKPXZLG-DEOSSOPVSA-N |
| XLogP | 4.86 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |