C21H25N3O4 — CID 92706694
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(5R)-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methanone (PubChem CID 92706694) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(5R)-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(5R)-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methanone |
|---|---|
| PubChem CID | 92706694 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(5R)-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methanone |
| SMILES | C[C@@H]1CCc2onc(C(=O)N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2C1 |
| InChI | InChI=1S/C21H25N3O4/c1-14-2-4-17-16(10-14)20(22-28-17)21(25)24-8-6-23(7-9-24)12-15-3-5-18-19(11-15)27-13-26-18/h3,5,11,14H,2,4,6-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | NJEKDSUJWHVAHY-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |