C17H20N4O4 — CID 2633887
2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 2633887) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2633887 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN1C(=O)N[C@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N4O4/c1-2-10-18-16(24)20-14(22)11-21-15(23)13(19-17(21)25)9-8-12-6-4-3-5-7-12/h2-7,13H,1,8-11H2,(H,19,25)(H2,18,20,22,24)/t13-/m1/s1 |
| InChIKey | ALJRUFIFPSFOHG-CYBMUJFWSA-N |
| XLogP | 0.55 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|