C23H28N2O4 — CID 26341732
3-[(3-hydroxypropylamino)methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one (PubChem CID 26341732) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[(3-hydroxypropylamino)methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one.
| Compound Name | 3-[(3-hydroxypropylamino)methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one |
|---|---|
| PubChem CID | 26341732 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[(3-hydroxypropylamino)methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one |
| SMILES | COc1cc2cc(CNCCCO)c(=O)n(Cc3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C23H28N2O4/c1-16-5-7-17(8-6-16)15-25-20-13-22(29-3)21(28-2)12-18(20)11-19(23(25)27)14-24-9-4-10-26/h5-8,11-13,24,26H,4,9-10,14-15H2,1-3H3 |
| InChIKey | VGWPFAVHHKLWGI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|