C27H32N4O3 — CID 118758749
3-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one (PubChem CID 118758749) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one.
| Compound Name | 3-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one |
|---|---|
| PubChem CID | 118758749 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-6,7-dimethoxy-1-[(4-methylphenyl)methyl]quinolin-2-one |
| SMILES | COc1cc2cc(CNCCn3nc(C)cc3C)c(=O)n(Cc3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C27H32N4O3/c1-18-6-8-21(9-7-18)17-30-24-15-26(34-5)25(33-4)14-22(24)13-23(27(30)32)16-28-10-11-31-20(3)12-19(2)29-31/h6-9,12-15,28H,10-11,16-17H2,1-5H3 |
| InChIKey | JHVPOCPACUMWNR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|