C31H33N3O3 — CID 26342132
N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-3-(2-oxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 26342132) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-3-(2-oxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-3-(2-oxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26342132 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-3-(2-oxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(N2CCCC2=O)c1)N(Cc1cccc(OC[C@H]2CC=CCC2)c1)Cc1ccccn1 |
| InChI | InChI=1S/C31H33N3O3/c35-30-16-8-18-34(30)28-14-7-12-26(20-28)31(36)33(22-27-13-4-5-17-32-27)21-25-11-6-15-29(19-25)37-23-24-9-2-1-3-10-24/h1-2,4-7,11-15,17,19-20,24H,3,8-10,16,18,21-23H2/t24-/m0/s1 |
| InChIKey | UYNNMDFOKSZRIX-DEOSSOPVSA-N |
| XLogP | 5.79 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|