C25H26N2O3 — CID 26349493
N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-N-(pyridin-2-ylmethyl)furan-2-carboxamide (PubChem CID 26349493) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-N-(pyridin-2-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-N-(pyridin-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 26349493 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[[3-[[(1R)-cyclohex-3-en-1-yl]methoxy]phenyl]methyl]-N-(pyridin-2-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(Cc1cccc(OC[C@H]2CC=CCC2)c1)Cc1ccccn1 |
| InChI | InChI=1S/C25H26N2O3/c28-25(24-13-7-15-29-24)27(18-22-11-4-5-14-26-22)17-21-10-6-12-23(16-21)30-19-20-8-2-1-3-9-20/h1-2,4-7,10-16,20H,3,8-9,17-19H2/t20-/m0/s1 |
| InChIKey | HYMDDRZCFUIVCH-FQEVSTJZSA-N |
| XLogP | 5.25 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|