C15H13F3N4S — CID 26343224
4-methyl-5-(1-methylpyrazol-3-yl)-N-[(2,3,6-trifluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 26343224) has the molecular formula C15H13F3N4S and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-methyl-5-(1-methylpyrazol-3-yl)-N-[(2,3,6-trifluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-(1-methylpyrazol-3-yl)-N-[(2,3,6-trifluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 26343224 |
| Molecular Formula | C15H13F3N4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-methyl-5-(1-methylpyrazol-3-yl)-N-[(2,3,6-trifluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NCc2c(F)ccc(F)c2F)sc1-c1ccn(C)n1 |
| InChI | InChI=1S/C15H13F3N4S/c1-8-14(12-5-6-22(2)21-12)23-15(20-8)19-7-9-10(16)3-4-11(17)13(9)18/h3-6H,7H2,1-2H3,(H,19,20) |
| InChIKey | WJWNPOSOPQULDQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|