C8H10N4S — CID 6485390
4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 6485390) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6485390 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1nn(C)cc1-c1csc(N)n1 |
| InChI | InChI=1S/C8H10N4S/c1-5-6(3-12(2)11-5)7-4-13-8(9)10-7/h3-4H,1-2H3,(H2,9,10) |
| InChIKey | BAZMMNWMHWSUPN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |