C7H8N4S — CID 6485389
4-(1-methylpyrazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 6485389) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-methylpyrazol-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6485389 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | Cn1cc(-c2csc(N)n2)cn1 |
| InChI | InChI=1S/C7H8N4S/c1-11-3-5(2-9-11)6-4-12-7(8)10-6/h2-4H,1H3,(H2,8,10) |
| InChIKey | PUIIDWPCXZVQEG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |