C15H26N2O2 — CID 26349680
1-(2-cyclopentylacetyl)-4-propyl-1,4-diazepan-5-one (PubChem CID 26349680) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(2-cyclopentylacetyl)-4-propyl-1,4-diazepan-5-one.
| Compound Name | 1-(2-cyclopentylacetyl)-4-propyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26349680 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-(2-cyclopentylacetyl)-4-propyl-1,4-diazepan-5-one |
| SMILES | CCCN1CCN(C(=O)CC2CCCC2)CCC1=O |
| InChI | InChI=1S/C15H26N2O2/c1-2-8-16-10-11-17(9-7-14(16)18)15(19)12-13-5-3-4-6-13/h13H,2-12H2,1H3 |
| InChIKey | HVZRIRPHMGOWPM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |