C18H26N2O2 — CID 26280630
1-(4-phenylbutanoyl)-4-propyl-1,4-diazepan-5-one (PubChem CID 26280630) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(4-phenylbutanoyl)-4-propyl-1,4-diazepan-5-one.
| Compound Name | 1-(4-phenylbutanoyl)-4-propyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26280630 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-(4-phenylbutanoyl)-4-propyl-1,4-diazepan-5-one |
| SMILES | CCCN1CCN(C(=O)CCCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C18H26N2O2/c1-2-12-19-14-15-20(13-11-18(19)22)17(21)10-6-9-16-7-4-3-5-8-16/h3-5,7-8H,2,6,9-15H2,1H3 |
| InChIKey | RGIAHIKZIGCBAU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |