C19H19ClF2N2O3S — CID 26359533
4-chloro-N-(2,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzamide (PubChem CID 26359533) has the molecular formula C19H19ClF2N2O3S and a molecular weight of 428.89 g/mol. Its IUPAC name is 4-chloro-N-(2,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzamide.
| Compound Name | 4-chloro-N-(2,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 26359533 |
| Molecular Formula | C19H19ClF2N2O3S |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-chloro-N-(2,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzamide |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2cc(C(=O)Nc3ccc(F)cc3F)ccc2Cl)C1 |
| InChI | InChI=1S/C19H19ClF2N2O3S/c1-12-3-2-8-24(11-12)28(26,27)18-9-13(4-6-15(18)20)19(25)23-17-7-5-14(21)10-16(17)22/h4-7,9-10,12H,2-3,8,11H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | QJNANPHTVZFZEQ-LBPRGKRZSA-N |
| XLogP | 4.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |