C17H21ClN4O3S — CID 60518959
4-chloro-3-(3-methylpiperidin-1-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)benzamide (PubChem CID 60518959) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is 4-chloro-3-(3-methylpiperidin-1-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 4-chloro-3-(3-methylpiperidin-1-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 60518959 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 4-chloro-3-(3-methylpiperidin-1-yl)sulfonyl-N-(5-methyl-1H-pyrazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCC(C)C3)c2)n[nH]1 |
| InChI | InChI=1S/C17H21ClN4O3S/c1-11-4-3-7-22(10-11)26(24,25)15-9-13(5-6-14(15)18)17(23)19-16-8-12(2)20-21-16/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | BVZDXHDIOJQEFR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |