C17H12F2N2O2 — CID 26360076
N-(2,4-difluorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 26360076) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 26360076 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H12F2N2O2/c1-10-15(21-17(23-10)11-5-3-2-4-6-11)16(22)20-14-8-7-12(18)9-13(14)19/h2-9H,1H3,(H,20,22) |
| InChIKey | VSRXAQYJLFGNFO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |