C17H13Cl2N3O2 — CID 90882730
N-(2-amino-4,5-dichlorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 90882730) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is N-(2-amino-4,5-dichlorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-amino-4,5-dichlorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90882730 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(2-amino-4,5-dichlorophenyl)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)Nc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-9-15(22-17(24-9)10-5-3-2-4-6-10)16(23)21-14-8-12(19)11(18)7-13(14)20/h2-8H,20H2,1H3,(H,21,23) |
| InChIKey | MVWBQXZPCKJDGX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|