C23H22N6OS — CID 26360900
(4-benzylpiperazin-1-yl)-[3-(tetrazol-1-yl)-5-thiophen-2-ylphenyl]methanone (PubChem CID 26360900) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-(tetrazol-1-yl)-5-thiophen-2-ylphenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-(tetrazol-1-yl)-5-thiophen-2-ylphenyl]methanone |
|---|---|
| PubChem CID | 26360900 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-(tetrazol-1-yl)-5-thiophen-2-ylphenyl]methanone |
| SMILES | O=C(c1cc(-c2cccs2)cc(-n2cnnn2)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H22N6OS/c30-23(28-10-8-27(9-11-28)16-18-5-2-1-3-6-18)20-13-19(22-7-4-12-31-22)14-21(15-20)29-17-24-25-26-29/h1-7,12-15,17H,8-11,16H2 |
| InChIKey | HGUWLSFTLGOZBH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |