C18H25N5OS — CID 26362247
N-cyclopentyl-1-[(3S)-1-(thiophen-3-ylmethyl)piperidin-3-yl]triazole-4-carboxamide (PubChem CID 26362247) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N-cyclopentyl-1-[(3S)-1-(thiophen-3-ylmethyl)piperidin-3-yl]triazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[(3S)-1-(thiophen-3-ylmethyl)piperidin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 26362247 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-cyclopentyl-1-[(3S)-1-(thiophen-3-ylmethyl)piperidin-3-yl]triazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cn([C@H]2CCCN(Cc3ccsc3)C2)nn1 |
| InChI | InChI=1S/C18H25N5OS/c24-18(19-15-4-1-2-5-15)17-12-23(21-20-17)16-6-3-8-22(11-16)10-14-7-9-25-13-14/h7,9,12-13,15-16H,1-6,8,10-11H2,(H,19,24)/t16-/m0/s1 |
| InChIKey | BKRDUJKSSFWTSN-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |